C35H49NO5 — CID 118015910
2,2-dimethylpropyl 2-[9-acetyl-4-(dimethylamino)-1,5a,6a,8,10a,11-hexamethyl-10,12-dioxo-6,7,11,11a-tetrahydro-5H-tetracen-2-yl]acetate (PubChem CID 118015910) has the molecular formula C35H49NO5 and a molecular weight of 563.78 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[9-acetyl-4-(dimethylamino)-1,5a,6a,8,10a,11-hexamethyl-10,12-dioxo-6,7,11,11a-tetrahydro-5H-tetracen-2-yl]acetate.
| Compound Name | 2,2-dimethylpropyl 2-[9-acetyl-4-(dimethylamino)-1,5a,6a,8,10a,11-hexamethyl-10,12-dioxo-6,7,11,11a-tetrahydro-5H-tetracen-2-yl]acetate |
|---|---|
| PubChem CID | 118015910 |
| Molecular Formula | C35H49NO5 |
| Molecular Weight | 563.78 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | 2,2-dimethylpropyl 2-[9-acetyl-4-(dimethylamino)-1,5a,6a,8,10a,11-hexamethyl-10,12-dioxo-6,7,11,11a-tetrahydro-5H-tetracen-2-yl]acetate |
| SMILES | CC(=O)C1=C(C)CC2(C)CC3(C)Cc4c(N(C)C)cc(CC(=O)OCC(C)(C)C)c(C)c4C(=O)C3C(C)C2(C)C1=O |
| InChI | InChI=1S/C35H49NO5/c1-19-15-34(9)17-33(8)16-24-25(36(11)12)13-23(14-26(38)41-18-32(5,6)7)20(2)28(24)30(39)29(33)21(3)35(34,10)31(40)27(19)22(4)37/h13,21,29H,14-18H2,1-12H3 |
| InChIKey | HUKBFGVVNZEFFQ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.78 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|