C35H52O4 — CID 118015562
2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(4-methyl-3-oxopentyl)-7-propan-2-yl-5,6,6a,7,10,10a,11a,12-octahydro-4H-tetracene-1,11-dione (PubChem CID 118015562) has the molecular formula C35H52O4 and a molecular weight of 536.80 g/mol. Its IUPAC name is 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(4-methyl-3-oxopentyl)-7-propan-2-yl-5,6,6a,7,10,10a,11a,12-octahydro-4H-tetracene-1,11-dione.
| Compound Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(4-methyl-3-oxopentyl)-7-propan-2-yl-5,6,6a,7,10,10a,11a,12-octahydro-4H-tetracene-1,11-dione |
|---|---|
| PubChem CID | 118015562 |
| Molecular Formula | C35H52O4 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.39 |
| IUPAC Name | 2-acetyl-3,4a,5a,10,12,12a-hexamethyl-9-(4-methyl-3-oxopentyl)-7-propan-2-yl-5,6,6a,7,10,10a,11a,12-octahydro-4H-tetracene-1,11-dione |
| SMILES | CC(=O)C1=C(C)CC2(C)CC3(C)CC4C(C(C)C)C=C(CCC(=O)C(C)C)C(C)C4C(=O)C3C(C)C2(C)C1=O |
| InChI | InChI=1S/C35H52O4/c1-18(2)25-14-24(12-13-27(37)19(3)4)21(6)29-26(25)16-33(9)17-34(10)15-20(5)28(23(8)36)32(39)35(34,11)22(7)30(33)31(29)38/h14,18-19,21-22,25-26,29-30H,12-13,15-17H2,1-11H3 |
| InChIKey | CHRLKDWZVXTTJS-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|