C36H48O5 — CID 122680478
(4aS,5aR,12aR)-2-acetyl-9-(5,5-dimethyl-2-oxohexyl)-10,12a-dihydroxy-3,4a,5a,12-tetramethyl-11-methylidene-7-propan-2-yl-5,6-dihydro-4H-tetracen-1-one (PubChem CID 122680478) has the molecular formula C36H48O5 and a molecular weight of 560.78 g/mol. Its IUPAC name is (4aS,5aR,12aR)-2-acetyl-9-(5,5-dimethyl-2-oxohexyl)-10,12a-dihydroxy-3,4a,5a,12-tetramethyl-11-methylidene-7-propan-2-yl-5,6-dihydro-4H-tetracen-1-one.
| Compound Name | (4aS,5aR,12aR)-2-acetyl-9-(5,5-dimethyl-2-oxohexyl)-10,12a-dihydroxy-3,4a,5a,12-tetramethyl-11-methylidene-7-propan-2-yl-5,6-dihydro-4H-tetracen-1-one |
|---|---|
| PubChem CID | 122680478 |
| Molecular Formula | C36H48O5 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | (4aS,5aR,12aR)-2-acetyl-9-(5,5-dimethyl-2-oxohexyl)-10,12a-dihydroxy-3,4a,5a,12-tetramethyl-11-methylidene-7-propan-2-yl-5,6-dihydro-4H-tetracen-1-one |
| SMILES | C=C1C2=C(C)[C@@]3(O)C(=O)C(C(C)=O)=C(C)C[C@@]3(C)C[C@@]2(C)Cc2c(C(C)C)cc(CC(=O)CCC(C)(C)C)c(O)c21 |
| InChI | InChI=1S/C36H48O5/c1-19(2)26-15-24(14-25(38)12-13-33(7,8)9)31(39)29-21(4)30-22(5)36(41)32(40)28(23(6)37)20(3)16-35(36,11)18-34(30,10)17-27(26)29/h15,19,39,41H,4,12-14,16-18H2,1-3,5-11H3/t34-,35+,36-/m1/s1 |
| InChIKey | JPVMRVNHTJNNCP-ZTJXOPACSA-N |
| XLogP | 7.36 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|