C39H44O9 — CID 123331944
(4aR,5aR,12aR)-2-acetyl-9-[3-(4-acetylphenyl)-2-oxopropyl]-10,12a-dihydroxy-4a,5a-dimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123331944) has the molecular formula C39H44O9 and a molecular weight of 656.77 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-9-[3-(4-acetylphenyl)-2-oxopropyl]-10,12a-dihydroxy-4a,5a-dimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-9-[3-(4-acetylphenyl)-2-oxopropyl]-10,12a-dihydroxy-4a,5a-dimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123331944 |
| Molecular Formula | C39H44O9 |
| Molecular Weight | 656.77 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-9-[3-(4-acetylphenyl)-2-oxopropyl]-10,12a-dihydroxy-4a,5a-dimethyl-4,7-di(propan-2-yl)-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)c1ccc(CC(=O)Cc2cc(C(C)C)c3c(c2O)C(=O)C2C(=O)[C@@]4(O)C(=O)C(C(C)=O)C(=O)C(C(C)C)[C@@]4(C)C[C@@]2(C)C3)cc1 |
| InChI | InChI=1S/C39H44O9/c1-18(2)26-15-24(14-25(42)13-22-9-11-23(12-10-22)20(5)40)32(43)29-27(26)16-37(7)17-38(8)30(19(3)4)33(44)28(21(6)41)35(46)39(38,48)36(47)31(37)34(29)45/h9-12,15,18-19,28,30-31,43,48H,13-14,16-17H2,1-8H3/t28?,30?,31?,37-,38-,39+/m1/s1 |
| InChIKey | UQCRTMZINHWUFN-CZHPUPTFSA-N |
| XLogP | 4.77 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|