C39H40O7 — CID 123918692
(4aR,5aR,12aR)-2-acetyl-12a-hydroxy-4a,5a-dimethyl-3,10-bis(phenylmethoxy)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,11,12-trione (PubChem CID 123918692) has the molecular formula C39H40O7 and a molecular weight of 620.74 g/mol. Its IUPAC name is (4aR,5aR,12aR)-2-acetyl-12a-hydroxy-4a,5a-dimethyl-3,10-bis(phenylmethoxy)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,11,12-trione.
| Compound Name | (4aR,5aR,12aR)-2-acetyl-12a-hydroxy-4a,5a-dimethyl-3,10-bis(phenylmethoxy)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,11,12-trione |
|---|---|
| PubChem CID | 123918692 |
| Molecular Formula | C39H40O7 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | (4aR,5aR,12aR)-2-acetyl-12a-hydroxy-4a,5a-dimethyl-3,10-bis(phenylmethoxy)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,11,12-trione |
| SMILES | CC(=O)C1=C(OCc2ccccc2)C(C(C)C)[C@@]2(C)C[C@@]3(C)Cc4cccc(OCc5ccccc5)c4C(=O)C3C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C39H40O7/c1-23(2)31-34(46-21-26-15-10-7-11-16-26)29(24(3)40)35(42)39(44)36(43)32-33(41)30-27(19-37(32,4)22-38(31,39)5)17-12-18-28(30)45-20-25-13-8-6-9-14-25/h6-18,23,31-32,44H,19-22H2,1-5H3/t31?,32?,37-,38-,39+/m1/s1 |
| InChIKey | KOBSDKTXXBJEEO-NIYKCDRHSA-N |
| XLogP | 6.25 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|