C35H40O6 — CID 91036904
(4R,4aS,5S,5aS,6R,12aS)-2-acetyl-10,12a-dihydroxy-3,4a,5,5a,6-pentamethyl-9-(4-methylphenyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,11,12-trione (PubChem CID 91036904) has the molecular formula C35H40O6 and a molecular weight of 556.70 g/mol. Its IUPAC name is (4R,4aS,5S,5aS,6R,12aS)-2-acetyl-10,12a-dihydroxy-3,4a,5,5a,6-pentamethyl-9-(4-methylphenyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,11,12-trione.
| Compound Name | (4R,4aS,5S,5aS,6R,12aS)-2-acetyl-10,12a-dihydroxy-3,4a,5,5a,6-pentamethyl-9-(4-methylphenyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,11,12-trione |
|---|---|
| PubChem CID | 91036904 |
| Molecular Formula | C35H40O6 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | (4R,4aS,5S,5aS,6R,12aS)-2-acetyl-10,12a-dihydroxy-3,4a,5,5a,6-pentamethyl-9-(4-methylphenyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,11,12-trione |
| SMILES | CC(=O)C1=C(C)[C@@H](C(C)C)[C@]2(C)[C@@H](C)[C@@]3(C)C(C(=O)c4c(ccc(-c5ccc(C)cc5)c4O)[C@@H]3C)C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C35H40O6/c1-16(2)27-18(4)25(20(6)36)31(39)35(41)32(40)28-30(38)26-23(19(5)33(28,8)21(7)34(27,35)9)14-15-24(29(26)37)22-12-10-17(3)11-13-22/h10-16,19,21,27-28,37,41H,1-9H3/t19-,21-,27+,28?,33-,34-,35+/m0/s1 |
| InChIKey | WLHLEXZCUDKZRA-NTYUUHPRSA-N |
| XLogP | 6.01 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|