C31H34O8 — CID 123941244
(4aS,5R,5aS,6R,12aR)-2-acetyl-9-cyclopenta-1,3-dien-1-yl-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123941244) has the molecular formula C31H34O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is (4aS,5R,5aS,6R,12aR)-2-acetyl-9-cyclopenta-1,3-dien-1-yl-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aS,5R,5aS,6R,12aR)-2-acetyl-9-cyclopenta-1,3-dien-1-yl-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123941244 |
| Molecular Formula | C31H34O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (4aS,5R,5aS,6R,12aR)-2-acetyl-9-cyclopenta-1,3-dien-1-yl-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C(C(C)C)[C@@]2(C)[C@H](O)[C@]3(C)C(C(=O)c4c(ccc(C5=CC=CC5)c4O)[C@H]3C)C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C31H34O8/c1-13(2)21-24(34)19(15(4)32)26(36)31(39)27(37)22-25(35)20-17(14(3)29(22,5)28(38)30(21,31)6)11-12-18(23(20)33)16-9-7-8-10-16/h7-9,11-14,19,21-22,28,33,38-39H,10H2,1-6H3/t14-,19?,21?,22?,28-,29+,30+,31+/m1/s1 |
| InChIKey | IVVRRXCJJODYRH-QBDBVCJMSA-N |
| XLogP | 2.97 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|