C34H42O9 — CID 123272297
(4aR,5R,5aR,6S,12aR)-2-acetyl-5-(2,7-dioxooctyl)-10,12a-dihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123272297) has the molecular formula C34H42O9 and a molecular weight of 594.70 g/mol. Its IUPAC name is (4aR,5R,5aR,6S,12aR)-2-acetyl-5-(2,7-dioxooctyl)-10,12a-dihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5R,5aR,6S,12aR)-2-acetyl-5-(2,7-dioxooctyl)-10,12a-dihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123272297 |
| Molecular Formula | C34H42O9 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | (4aR,5R,5aR,6S,12aR)-2-acetyl-5-(2,7-dioxooctyl)-10,12a-dihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)CCCCC(=O)C[C@@H]1[C@]2(C)C(C(=O)c3c(O)cccc3[C@H]2C)C(=O)[C@@]2(O)C(=O)C(C(C)=O)C(=O)C(C(C)C)[C@@]12C |
| InChI | InChI=1S/C34H42O9/c1-16(2)26-28(39)24(19(5)36)30(41)34(43)31(42)27-29(40)25-21(13-10-14-22(25)38)18(4)32(27,6)23(33(26,34)7)15-20(37)12-9-8-11-17(3)35/h10,13-14,16,18,23-24,26-27,38,43H,8-9,11-12,15H2,1-7H3/t18-,23-,24?,26?,27?,32-,33-,34+/m1/s1 |
| InChIKey | NCNKXMUACSQCTO-OTXSVEKXSA-N |
| XLogP | 3.99 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|