C37H48O8 — CID 123258749
(4aR,5R,5aR,6S,12aR)-2-acetyl-7-(2-cyclopentylethyl)-10,12a-dihydroxy-4a,5a,6-trimethyl-5-(2-oxobutyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123258749) has the molecular formula C37H48O8 and a molecular weight of 620.78 g/mol. Its IUPAC name is (4aR,5R,5aR,6S,12aR)-2-acetyl-7-(2-cyclopentylethyl)-10,12a-dihydroxy-4a,5a,6-trimethyl-5-(2-oxobutyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5R,5aR,6S,12aR)-2-acetyl-7-(2-cyclopentylethyl)-10,12a-dihydroxy-4a,5a,6-trimethyl-5-(2-oxobutyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123258749 |
| Molecular Formula | C37H48O8 |
| Molecular Weight | 620.78 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | (4aR,5R,5aR,6S,12aR)-2-acetyl-7-(2-cyclopentylethyl)-10,12a-dihydroxy-4a,5a,6-trimethyl-5-(2-oxobutyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CCC(=O)C[C@@H]1[C@]2(C)C(C(=O)c3c(O)ccc(CCC4CCCC4)c3[C@H]2C)C(=O)[C@@]2(O)C(=O)C(C(C)=O)C(=O)C(C(C)C)[C@@]12C |
| InChI | InChI=1S/C37H48O8/c1-8-23(39)17-25-35(6)19(4)26-22(14-13-21-11-9-10-12-21)15-16-24(40)28(26)32(42)30(35)34(44)37(45)33(43)27(20(5)38)31(41)29(18(2)3)36(25,37)7/h15-16,18-19,21,25,27,29-30,40,45H,8-14,17H2,1-7H3/t19-,25-,27?,29?,30?,35-,36-,37+/m1/s1 |
| InChIKey | CVQFQAVXUHKRIS-IQEZEAAOSA-N |
| XLogP | 5.37 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.78 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|