C34H42O7 — CID 123527137
(4aR,5R,5aS,6S,12aR)-2-acetyl-6-(2-cyclopentylprop-2-enyl)-10,12a-dihydroxy-4a,5,5a-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123527137) has the molecular formula C34H42O7 and a molecular weight of 562.70 g/mol. Its IUPAC name is (4aR,5R,5aS,6S,12aR)-2-acetyl-6-(2-cyclopentylprop-2-enyl)-10,12a-dihydroxy-4a,5,5a-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5R,5aS,6S,12aR)-2-acetyl-6-(2-cyclopentylprop-2-enyl)-10,12a-dihydroxy-4a,5,5a-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123527137 |
| Molecular Formula | C34H42O7 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | (4aR,5R,5aS,6S,12aR)-2-acetyl-6-(2-cyclopentylprop-2-enyl)-10,12a-dihydroxy-4a,5,5a-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | C=C(C[C@@H]1c2cccc(O)c2C(=O)C2C(=O)[C@@]3(O)C(=O)C(C(C)=O)C(=O)C(C(C)C)[C@@]3(C)[C@H](C)[C@]21C)C1CCCC1 |
| InChI | InChI=1S/C34H42O7/c1-16(2)26-28(37)24(18(4)35)30(39)34(41)31(40)27-29(38)25-21(13-10-14-23(25)36)22(15-17(3)20-11-8-9-12-20)32(27,6)19(5)33(26,34)7/h10,13-14,16,19-20,22,24,26-27,36,41H,3,8-9,11-12,15H2,1-2,4-7H3/t19-,22-,24?,26?,27?,32+,33-,34+/m1/s1 |
| InChIKey | QTHHHPORLKTMNX-BIPSIBSNSA-N |
| XLogP | 5.02 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|