C34H38O8 — CID 123581276
(4aS,5R,5aS,6R,12aR)-2-acetyl-5,10,12a-trihydroxy-4a,5a-dimethyl-6-(3-phenylpropyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123581276) has the molecular formula C34H38O8 and a molecular weight of 574.67 g/mol. Its IUPAC name is (4aS,5R,5aS,6R,12aR)-2-acetyl-5,10,12a-trihydroxy-4a,5a-dimethyl-6-(3-phenylpropyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aS,5R,5aS,6R,12aR)-2-acetyl-5,10,12a-trihydroxy-4a,5a-dimethyl-6-(3-phenylpropyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123581276 |
| Molecular Formula | C34H38O8 |
| Molecular Weight | 574.67 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | (4aS,5R,5aS,6R,12aR)-2-acetyl-5,10,12a-trihydroxy-4a,5a-dimethyl-6-(3-phenylpropyl)-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C(C(C)C)[C@@]2(C)[C@H](O)[C@]3(C)C(C(=O)c4c(O)cccc4[C@H]3CCCc3ccccc3)C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C34H38O8/c1-17(2)25-27(37)23(18(3)35)29(39)34(42)30(40)26-28(38)24-20(14-10-16-22(24)36)21(32(26,4)31(41)33(25,34)5)15-9-13-19-11-7-6-8-12-19/h6-8,10-12,14,16-17,21,23,25-26,31,36,41-42H,9,13,15H2,1-5H3/t21-,23?,25?,26?,31-,32+,33+,34+/m1/s1 |
| InChIKey | MADPNJDTJQMKPK-NFOLFTIMSA-N |
| XLogP | 3.63 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|