C34H36O8 — CID 123486214
(4aS,5R,5aS,6R,12aR)-2-acetyl-9-(4-ethenylphenyl)-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123486214) has the molecular formula C34H36O8 and a molecular weight of 572.65 g/mol. Its IUPAC name is (4aS,5R,5aS,6R,12aR)-2-acetyl-9-(4-ethenylphenyl)-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aS,5R,5aS,6R,12aR)-2-acetyl-9-(4-ethenylphenyl)-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123486214 |
| Molecular Formula | C34H36O8 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | (4aS,5R,5aS,6R,12aR)-2-acetyl-9-(4-ethenylphenyl)-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | C=Cc1ccc(-c2ccc3c(c2O)C(=O)C2C(=O)[C@@]4(O)C(=O)C(C(C)=O)C(=O)C(C(C)C)[C@@]4(C)[C@H](O)[C@@]2(C)[C@@H]3C)cc1 |
| InChI | InChI=1S/C34H36O8/c1-8-18-9-11-19(12-10-18)21-14-13-20-16(4)32(6)25(28(38)23(20)26(21)36)30(40)34(42)29(39)22(17(5)35)27(37)24(15(2)3)33(34,7)31(32)41/h8-16,22,24-25,31,36,41-42H,1H2,2-7H3/t16-,22?,24?,25?,31-,32+,33+,34+/m1/s1 |
| InChIKey | XSRDKAZGAVGBGL-MZXNIZFGSA-N |
| XLogP | 3.93 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|