C31H36O10 — CID 123169424
prop-2-enyl 2-[(5R,5aS,6R,6aS,10aR)-9-acetyl-1,6,10a-trihydroxy-5,5a,6a-trimethyl-8,10,11,12-tetraoxo-7-propan-2-yl-5,6,7,11a-tetrahydrotetracen-2-yl]acetate (PubChem CID 123169424) has the molecular formula C31H36O10 and a molecular weight of 568.62 g/mol. Its IUPAC name is prop-2-enyl 2-[(5R,5aS,6R,6aS,10aR)-9-acetyl-1,6,10a-trihydroxy-5,5a,6a-trimethyl-8,10,11,12-tetraoxo-7-propan-2-yl-5,6,7,11a-tetrahydrotetracen-2-yl]acetate.
| Compound Name | prop-2-enyl 2-[(5R,5aS,6R,6aS,10aR)-9-acetyl-1,6,10a-trihydroxy-5,5a,6a-trimethyl-8,10,11,12-tetraoxo-7-propan-2-yl-5,6,7,11a-tetrahydrotetracen-2-yl]acetate |
|---|---|
| PubChem CID | 123169424 |
| Molecular Formula | C31H36O10 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | prop-2-enyl 2-[(5R,5aS,6R,6aS,10aR)-9-acetyl-1,6,10a-trihydroxy-5,5a,6a-trimethyl-8,10,11,12-tetraoxo-7-propan-2-yl-5,6,7,11a-tetrahydrotetracen-2-yl]acetate |
| SMILES | C=CCOC(=O)Cc1ccc2c(c1O)C(=O)C1C(=O)[C@@]3(O)C(=O)C(C(C)=O)C(=O)C(C(C)C)[C@@]3(C)[C@H](O)[C@@]1(C)[C@@H]2C |
| InChI | InChI=1S/C31H36O10/c1-8-11-41-18(33)12-16-9-10-17-14(4)29(6)22(25(36)20(17)23(16)34)27(38)31(40)26(37)19(15(5)32)24(35)21(13(2)3)30(31,7)28(29)39/h8-10,13-14,19,21-22,28,34,39-40H,1,11-12H2,2-7H3/t14-,19?,21?,22?,28-,29+,30+,31+/m1/s1 |
| InChIKey | BDDAFRHZXLLBLZ-QBDBVCJMSA-N |
| XLogP | 1.90 |
| TPSA | 172.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|