C34H42O9 — CID 123643548
(4aS,5R,5aS,6R,12aR)-2-acetyl-7-[(E)-5,5-dimethyl-3-oxohex-1-enyl]-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123643548) has the molecular formula C34H42O9 and a molecular weight of 594.70 g/mol. Its IUPAC name is (4aS,5R,5aS,6R,12aR)-2-acetyl-7-[(E)-5,5-dimethyl-3-oxohex-1-enyl]-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aS,5R,5aS,6R,12aR)-2-acetyl-7-[(E)-5,5-dimethyl-3-oxohex-1-enyl]-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123643548 |
| Molecular Formula | C34H42O9 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | (4aS,5R,5aS,6R,12aR)-2-acetyl-7-[(E)-5,5-dimethyl-3-oxohex-1-enyl]-5,10,12a-trihydroxy-4a,5a,6-trimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C(C(C)C)[C@@]2(C)[C@H](O)[C@]3(C)C(C(=O)c4c(O)ccc(/C=C/C(=O)CC(C)(C)C)c4[C@H]3C)C(=O)[C@@]2(O)C1=O |
| InChI | InChI=1S/C34H42O9/c1-15(2)24-26(38)22(17(4)35)28(40)34(43)29(41)25-27(39)23-20(37)13-11-18(10-12-19(36)14-31(5,6)7)21(23)16(3)32(25,8)30(42)33(24,34)9/h10-13,15-16,22,24-25,30,37,42-43H,14H2,1-9H3/b12-10+/t16-,22?,24?,25?,30-,32+,33+,34+/m1/s1 |
| InChIKey | PEKPYYIDMQZUNQ-ZWMXJLPGSA-N |
| XLogP | 3.64 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|