C26H33N3O8 — CID 91437538
(4S,4aR,5S,5aR,6S,12aS)-4,7-bis(dimethylamino)-5,10,12a-trihydroxy-4a,5a,6-trimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide (PubChem CID 91437538) has the molecular formula C26H33N3O8 and a molecular weight of 515.56 g/mol. Its IUPAC name is (4S,4aR,5S,5aR,6S,12aS)-4,7-bis(dimethylamino)-5,10,12a-trihydroxy-4a,5a,6-trimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aR,5S,5aR,6S,12aS)-4,7-bis(dimethylamino)-5,10,12a-trihydroxy-4a,5a,6-trimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91437538 |
| Molecular Formula | C26H33N3O8 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (4S,4aR,5S,5aR,6S,12aS)-4,7-bis(dimethylamino)-5,10,12a-trihydroxy-4a,5a,6-trimethyl-1,3,11,12-tetraoxo-4,5,6,11a-tetrahydrotetracene-2-carboxamide |
| SMILES | C[C@H]1c2c(N(C)C)ccc(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]3(C)[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C26H33N3O8/c1-10-13-11(28(4)5)8-9-12(30)14(13)17(31)16-21(34)26(37)20(33)15(22(27)35)18(32)19(29(6)7)25(26,3)23(36)24(10,16)2/h8-10,15-16,19,23,30,36-37H,1-7H3,(H2,27,35)/t10-,15?,16?,19+,23-,24+,25+,26+/m0/s1 |
| InChIKey | PZVQJDKDFYDIRC-VLUYPXRYSA-N |
| XLogP | -0.75 |
| TPSA | 178.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|