C28H38N2O6 — CID 123496705
4-(dimethylamino)-10,12-dihydroxy-4a,5,5a,6,6,7,12a-heptamethyl-1,3,11-trioxo-4,5,11a,12-tetrahydrotetracene-2-carboxamide (PubChem CID 123496705) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is 4-(dimethylamino)-10,12-dihydroxy-4a,5,5a,6,6,7,12a-heptamethyl-1,3,11-trioxo-4,5,11a,12-tetrahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-10,12-dihydroxy-4a,5,5a,6,6,7,12a-heptamethyl-1,3,11-trioxo-4,5,11a,12-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123496705 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 4-(dimethylamino)-10,12-dihydroxy-4a,5,5a,6,6,7,12a-heptamethyl-1,3,11-trioxo-4,5,11a,12-tetrahydrotetracene-2-carboxamide |
| SMILES | Cc1ccc(O)c2c1C(C)(C)C1(C)C(C2=O)C(O)C2(C)C(=O)C(C(N)=O)C(=O)C(N(C)C)C2(C)C1C |
| InChI | InChI=1S/C28H38N2O6/c1-12-10-11-14(31)15-17(12)25(3,4)26(5)13(2)27(6)21(30(8)9)20(33)16(24(29)36)22(34)28(27,7)23(35)18(26)19(15)32/h10-11,13,16,18,21,23,31,35H,1-9H3,(H2,29,36) |
| InChIKey | NHUDVDCYAUZVKT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|