C35H48O7 — CID 123533209
(4aR,5aR,12aR)-9-tert-butyl-2-(3,3-dimethylbutanoyl)-7-ethyl-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone (PubChem CID 123533209) has the molecular formula C35H48O7 and a molecular weight of 580.76 g/mol. Its IUPAC name is (4aR,5aR,12aR)-9-tert-butyl-2-(3,3-dimethylbutanoyl)-7-ethyl-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aR,5aR,12aR)-9-tert-butyl-2-(3,3-dimethylbutanoyl)-7-ethyl-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123533209 |
| Molecular Formula | C35H48O7 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | (4aR,5aR,12aR)-9-tert-butyl-2-(3,3-dimethylbutanoyl)-7-ethyl-10,12a-dihydroxy-4a,5a-dimethyl-4-propan-2-yl-4,5,6,11a-tetrahydrotetracene-1,3,11,12-tetrone |
| SMILES | CCc1cc(C(C)(C)C)c(O)c2c1C[C@]1(C)C[C@]3(C)C(C(C)C)C(=O)C(C(=O)CC(C)(C)C)C(=O)[C@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C35H48O7/c1-12-18-13-20(32(7,8)9)26(37)22-19(18)14-33(10)16-34(11)24(17(2)3)28(39)23(21(36)15-31(4,5)6)29(40)35(34,42)30(41)25(33)27(22)38/h13,17,23-25,37,42H,12,14-16H2,1-11H3/t23?,24?,25?,33-,34-,35+/m1/s1 |
| InChIKey | GJDMHQACFIRCBL-HAOJCECWSA-N |
| XLogP | 5.37 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|