C24H24Cl2N6O3 — CID 91002925
4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-4aH-phthalazin-1-yl)amino]butyl]butanamide (PubChem CID 91002925) has the molecular formula C24H24Cl2N6O3 and a molecular weight of 515.40 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-4aH-phthalazin-1-yl)amino]butyl]butanamide.
| Compound Name | 4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-4aH-phthalazin-1-yl)amino]butyl]butanamide |
|---|---|
| PubChem CID | 91002925 |
| Molecular Formula | C24H24Cl2N6O3 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]-N-[4-[(4-oxo-4aH-phthalazin-1-yl)amino]butyl]butanamide |
| SMILES | O=C(CCCc1nc(-c2cc(Cl)cc(Cl)c2)no1)NCCCCNC1=C2C=CC=CC2C(=O)N=N1 |
| InChI | InChI=1S/C24H24Cl2N6O3/c25-16-12-15(13-17(26)14-16)22-29-21(35-32-22)9-5-8-20(33)27-10-3-4-11-28-23-18-6-1-2-7-19(18)24(34)31-30-23/h1-2,6-7,12-14,19,28H,3-5,8-11H2,(H,27,33) |
| InChIKey | RNNCIYRTVFBXGF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|