C21H19N7O5 — CID 91295072
3-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-4aH-phthalazin-1-yl)amino]ethyl]propanamide (PubChem CID 91295072) has the molecular formula C21H19N7O5 and a molecular weight of 449.43 g/mol. Its IUPAC name is 3-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-4aH-phthalazin-1-yl)amino]ethyl]propanamide.
| Compound Name | 3-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-4aH-phthalazin-1-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 91295072 |
| Molecular Formula | C21H19N7O5 |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]-N-[2-[(4-oxo-4aH-phthalazin-1-yl)amino]ethyl]propanamide |
| SMILES | O=C(CCc1nc(-c2ccc([N+](=O)[O-])cc2)no1)NCCNC1=C2C=CC=CC2C(=O)N=N1 |
| InChI | InChI=1S/C21H19N7O5/c29-17(22-11-12-23-20-15-3-1-2-4-16(15)21(30)26-25-20)9-10-18-24-19(27-33-18)13-5-7-14(8-6-13)28(31)32/h1-8,16,23H,9-12H2,(H,22,29) |
| InChIKey | MVEXBJGNMJEJAU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 164.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|