C24H23F3N6O3 — CID 91548276
N-[3-[(4-oxo-4aH-phthalazin-1-yl)amino]propyl]-4-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]butanamide (PubChem CID 91548276) has the molecular formula C24H23F3N6O3 and a molecular weight of 500.48 g/mol. Its IUPAC name is N-[3-[(4-oxo-4aH-phthalazin-1-yl)amino]propyl]-4-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]butanamide.
| Compound Name | N-[3-[(4-oxo-4aH-phthalazin-1-yl)amino]propyl]-4-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]butanamide |
|---|---|
| PubChem CID | 91548276 |
| Molecular Formula | C24H23F3N6O3 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | N-[3-[(4-oxo-4aH-phthalazin-1-yl)amino]propyl]-4-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]butanamide |
| SMILES | O=C(CCCc1nc(-c2cccc(C(F)(F)F)c2)no1)NCCCNC1=C2C=CC=CC2C(=O)N=N1 |
| InChI | InChI=1S/C24H23F3N6O3/c25-24(26,27)16-7-3-6-15(14-16)21-30-20(36-33-21)11-4-10-19(34)28-12-5-13-29-22-17-8-1-2-9-18(17)23(35)32-31-22/h1-3,6-9,14,18,29H,4-5,10-13H2,(H,28,34) |
| InChIKey | CGVJANHDPCFQQX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|