C25H22F6N6O3 — CID 163541595
4-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-8H-phthalazin-1-yl)amino]propyl]butanamide (PubChem CID 163541595) has the molecular formula C25H22F6N6O3 and a molecular weight of 568.48 g/mol. Its IUPAC name is 4-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-8H-phthalazin-1-yl)amino]propyl]butanamide.
| Compound Name | 4-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-8H-phthalazin-1-yl)amino]propyl]butanamide |
|---|---|
| PubChem CID | 163541595 |
| Molecular Formula | C25H22F6N6O3 |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 4-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]-N-[3-[(4-oxo-8H-phthalazin-1-yl)amino]propyl]butanamide |
| SMILES | O=C(CCCc1nc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)no1)NCCCNC1=C2CC=CC=C2C(=O)N=N1 |
| InChI | InChI=1S/C25H22F6N6O3/c26-24(27,28)15-11-14(12-16(13-15)25(29,30)31)21-34-20(40-37-21)8-3-7-19(38)32-9-4-10-33-22-17-5-1-2-6-18(17)23(39)36-35-22/h1-2,6,11-13,33H,3-5,7-10H2,(H,32,38) |
| InChIKey | FBNWNQZLTJWNQD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|