C24H25N7O5 — CID 91269483
N-[2,2-dimethyl-3-[(4-oxo-4aH-phthalazin-1-yl)amino]propyl]-3-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 91269483) has the molecular formula C24H25N7O5 and a molecular weight of 491.51 g/mol. Its IUPAC name is N-[2,2-dimethyl-3-[(4-oxo-4aH-phthalazin-1-yl)amino]propyl]-3-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-[2,2-dimethyl-3-[(4-oxo-4aH-phthalazin-1-yl)amino]propyl]-3-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 91269483 |
| Molecular Formula | C24H25N7O5 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[2,2-dimethyl-3-[(4-oxo-4aH-phthalazin-1-yl)amino]propyl]-3-[3-(3-nitrophenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CC(C)(CNC(=O)CCc1nc(-c2cccc([N+](=O)[O-])c2)no1)CNC1=C2C=CC=CC2C(=O)N=N1 |
| InChI | InChI=1S/C24H25N7O5/c1-24(2,14-26-22-17-8-3-4-9-18(17)23(33)29-28-22)13-25-19(32)10-11-20-27-21(30-36-20)15-6-5-7-16(12-15)31(34)35/h3-9,12,18,26H,10-11,13-14H2,1-2H3,(H,25,32) |
| InChIKey | ZWTKLIZZTJRRMK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 164.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|