C37H46N2O2 — CID 91007602
4-[2-[4-[2-[7-(1-hydroxyethyl)-1H-indol-3-yl]ethylamino]-3-methylphenyl]octan-2-yl]-7-methyl-2,3-dihydroinden-1-one (PubChem CID 91007602) has the molecular formula C37H46N2O2 and a molecular weight of 550.79 g/mol. Its IUPAC name is 4-[2-[4-[2-[7-(1-hydroxyethyl)-1H-indol-3-yl]ethylamino]-3-methylphenyl]octan-2-yl]-7-methyl-2,3-dihydroinden-1-one.
| Compound Name | 4-[2-[4-[2-[7-(1-hydroxyethyl)-1H-indol-3-yl]ethylamino]-3-methylphenyl]octan-2-yl]-7-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 91007602 |
| Molecular Formula | C37H46N2O2 |
| Molecular Weight | 550.79 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | 4-[2-[4-[2-[7-(1-hydroxyethyl)-1H-indol-3-yl]ethylamino]-3-methylphenyl]octan-2-yl]-7-methyl-2,3-dihydroinden-1-one |
| SMILES | CCCCCCC(C)(c1ccc(NCCc2c[nH]c3c(C(C)O)cccc23)c(C)c1)c1ccc(C)c2c1CCC2=O |
| InChI | InChI=1S/C37H46N2O2/c1-6-7-8-9-20-37(5,32-16-13-24(2)35-31(32)15-18-34(35)41)28-14-17-33(25(3)22-28)38-21-19-27-23-39-36-29(26(4)40)11-10-12-30(27)36/h10-14,16-17,22-23,26,38-40H,6-9,15,18-21H2,1-5H3 |
| InChIKey | UVZDNKOTECZGQW-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.79 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|