C8H5N3 — CID 91010476
3H-azepine-6,7-dicarbonitrile (PubChem CID 91010476) has the molecular formula C8H5N3 and a molecular weight of 143.15 g/mol. Its IUPAC name is 3H-azepine-6,7-dicarbonitrile.
| Compound Name | 3H-azepine-6,7-dicarbonitrile |
|---|---|
| PubChem CID | 91010476 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 3H-azepine-6,7-dicarbonitrile |
| SMILES | N#CC1=C(C#N)N=CCC=C1 |
| InChI | InChI=1S/C8H5N3/c9-5-7-3-1-2-4-11-8(7)6-10/h1,3-4H,2H2 |
| InChIKey | BFSAQWHISUCOEX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |