C8H8N2 — CID 59083003
2-(ethylideneamino)cyclopenta-1,4-diene-1-carbonitrile (PubChem CID 59083003) has the molecular formula C8H8N2 and a molecular weight of 132.17 g/mol. Its IUPAC name is 2-(ethylideneamino)cyclopenta-1,4-diene-1-carbonitrile.
| Compound Name | 2-(ethylideneamino)cyclopenta-1,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 59083003 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 2-(ethylideneamino)cyclopenta-1,4-diene-1-carbonitrile |
| SMILES | C/C=N/C1=C(C#N)C=CC1 |
| InChI | InChI=1S/C8H8N2/c1-2-10-8-5-3-4-7(8)6-9/h2-4H,5H2,1H3/b10-2+ |
| InChIKey | QCPHAZAPOBEGOM-WTDSWWLTSA-N |
| XLogP | 1.81 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|