C12H16N2 — CID 123941357
7-(ethylideneamino)-2,5,6-trimethylhepta-2,4,6-trienenitrile (PubChem CID 123941357) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 7-(ethylideneamino)-2,5,6-trimethylhepta-2,4,6-trienenitrile.
| Compound Name | 7-(ethylideneamino)-2,5,6-trimethylhepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 123941357 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 7-(ethylideneamino)-2,5,6-trimethylhepta-2,4,6-trienenitrile |
| SMILES | C/C=N/C=C(C)C(C)=CC=C(C)C#N |
| InChI | InChI=1S/C12H16N2/c1-5-14-9-12(4)11(3)7-6-10(2)8-13/h5-7,9H,1-4H3/b10-6?,11-7?,12-9?,14-5+ |
| InChIKey | UQQMGCSCGDBGBJ-KESVQCILSA-N |
| XLogP | 3.40 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|