C10H17N — CID 123756483
N-[(1Z)-2,4-dimethylhexa-1,3-dienyl]ethanimine (PubChem CID 123756483) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[(1Z)-2,4-dimethylhexa-1,3-dienyl]ethanimine.
| Compound Name | N-[(1Z)-2,4-dimethylhexa-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 123756483 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[(1Z)-2,4-dimethylhexa-1,3-dienyl]ethanimine |
| SMILES | C/C=N/C=C(/C)C=C(C)CC |
| InChI | InChI=1S/C10H17N/c1-5-9(3)7-10(4)8-11-6-2/h6-8H,5H2,1-4H3/b9-7?,10-8-,11-6+ |
| InChIKey | SJPVLDMSZXYVKA-JCDXLBIOSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|