C14H17ClN4O — CID 91014746
(6-chloro-4-methylpyrazolo[5,4-b]pyridin-1-yl)-(4-methylpiperidin-1-yl)methanone (PubChem CID 91014746) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is (6-chloro-4-methylpyrazolo[5,4-b]pyridin-1-yl)-(4-methylpiperidin-1-yl)methanone.
| Compound Name | (6-chloro-4-methylpyrazolo[5,4-b]pyridin-1-yl)-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 91014746 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (6-chloro-4-methylpyrazolo[5,4-b]pyridin-1-yl)-(4-methylpiperidin-1-yl)methanone |
| SMILES | Cc1cc(Cl)nc2c1cnn2C(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C14H17ClN4O/c1-9-3-5-18(6-4-9)14(20)19-13-11(8-16-19)10(2)7-12(15)17-13/h7-9H,3-6H2,1-2H3 |
| InChIKey | KAUCWEBZLWOBLE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|