C21H21F3N2O — CID 91014863
3-(3,4-difluorophenyl)-2-[1-[(4-fluorophenyl)methyl]piperidin-4-ylidene]propanamide (PubChem CID 91014863) has the molecular formula C21H21F3N2O and a molecular weight of 374.41 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-2-[1-[(4-fluorophenyl)methyl]piperidin-4-ylidene]propanamide.
| Compound Name | 3-(3,4-difluorophenyl)-2-[1-[(4-fluorophenyl)methyl]piperidin-4-ylidene]propanamide |
|---|---|
| PubChem CID | 91014863 |
| Molecular Formula | C21H21F3N2O |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-(3,4-difluorophenyl)-2-[1-[(4-fluorophenyl)methyl]piperidin-4-ylidene]propanamide |
| SMILES | NC(=O)C(Cc1ccc(F)c(F)c1)=C1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H21F3N2O/c22-17-4-1-14(2-5-17)13-26-9-7-16(8-10-26)18(21(25)27)11-15-3-6-19(23)20(24)12-15/h1-6,12H,7-11,13H2,(H2,25,27) |
| InChIKey | YTMNPPFXPVBDBX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|