C31H40ClN3O2 — CID 91020180
1-[6-chloro-3-[4-(2-cyclohexyl-4-phenylpiperidine-1-carbonyl)-3-methylpyrrolidin-3-yl]-2-pyridinyl]propan-1-one (PubChem CID 91020180) has the molecular formula C31H40ClN3O2 and a molecular weight of 522.13 g/mol. Its IUPAC name is 1-[6-chloro-3-[4-(2-cyclohexyl-4-phenylpiperidine-1-carbonyl)-3-methylpyrrolidin-3-yl]-2-pyridinyl]propan-1-one.
| Compound Name | 1-[6-chloro-3-[4-(2-cyclohexyl-4-phenylpiperidine-1-carbonyl)-3-methylpyrrolidin-3-yl]-2-pyridinyl]propan-1-one |
|---|---|
| PubChem CID | 91020180 |
| Molecular Formula | C31H40ClN3O2 |
| Molecular Weight | 522.13 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 1-[6-chloro-3-[4-(2-cyclohexyl-4-phenylpiperidine-1-carbonyl)-3-methylpyrrolidin-3-yl]-2-pyridinyl]propan-1-one |
| SMILES | CCC(=O)c1nc(Cl)ccc1C1(C)CNCC1C(=O)N1CCC(c2ccccc2)CC1C1CCCCC1 |
| InChI | InChI=1S/C31H40ClN3O2/c1-3-27(36)29-24(14-15-28(32)34-29)31(2)20-33-19-25(31)30(37)35-17-16-23(21-10-6-4-7-11-21)18-26(35)22-12-8-5-9-13-22/h4,6-7,10-11,14-15,22-23,25-26,33H,3,5,8-9,12-13,16-20H2,1-2H3 |
| InChIKey | HHOUSHRTINCNSO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.13 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|