C28H18Cl2N2O5S — CID 91020768
5-[[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91020768) has the molecular formula C28H18Cl2N2O5S and a molecular weight of 565.43 g/mol. Its IUPAC name is 5-[[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91020768 |
| Molecular Formula | C28H18Cl2N2O5S |
| Molecular Weight | 565.43 g/mol |
| Exact Mass | 564.03 |
| IUPAC Name | 5-[[5-[(3,4-dichlorophenoxy)methyl]furan-2-yl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccc(Oc3ccccc3)cc2)C(=O)C1=Cc1ccc(COc2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C28H18Cl2N2O5S/c29-24-13-12-20(15-25(24)30)35-16-22-11-10-21(37-22)14-23-26(33)31-28(38)32(27(23)34)17-6-8-19(9-7-17)36-18-4-2-1-3-5-18/h1-15H,16H2,(H,31,33,38) |
| InChIKey | LWRQWLMCYGISHH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.43 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|