C19H20F3NO3 — CID 91023968
4,4,4-trifluoro-3-(1-phenylethylamino)-2-phenylmethoxybutanoic acid (PubChem CID 91023968) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(1-phenylethylamino)-2-phenylmethoxybutanoic acid.
| Compound Name | 4,4,4-trifluoro-3-(1-phenylethylamino)-2-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 91023968 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 4,4,4-trifluoro-3-(1-phenylethylamino)-2-phenylmethoxybutanoic acid |
| SMILES | CC(NC(C(OCc1ccccc1)C(=O)O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H20F3NO3/c1-13(15-10-6-3-7-11-15)23-17(19(20,21)22)16(18(24)25)26-12-14-8-4-2-5-9-14/h2-11,13,16-17,23H,12H2,1H3,(H,24,25) |
| InChIKey | JGIFYOXPRUUXTQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |