C18H24N2O6 — CID 91024830
(2S)-2-(phenylmethoxycarbonylamino)-4-piperidin-1-ylpentanedioic acid (PubChem CID 91024830) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is (2S)-2-(phenylmethoxycarbonylamino)-4-piperidin-1-ylpentanedioic acid.
| Compound Name | (2S)-2-(phenylmethoxycarbonylamino)-4-piperidin-1-ylpentanedioic acid |
|---|---|
| PubChem CID | 91024830 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (2S)-2-(phenylmethoxycarbonylamino)-4-piperidin-1-ylpentanedioic acid |
| SMILES | O=C(N[C@@H](CC(C(=O)O)N1CCCCC1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C18H24N2O6/c21-16(22)14(11-15(17(23)24)20-9-5-2-6-10-20)19-18(25)26-12-13-7-3-1-4-8-13/h1,3-4,7-8,14-15H,2,5-6,9-12H2,(H,19,25)(H,21,22)(H,23,24)/t14-,15?/m0/s1 |
| InChIKey | KNSYPKZGDHJPKL-MLCCFXAWSA-N |
| XLogP | 1.70 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |