C17H12F3N5O2 — CID 9102658
(2R)-N-(4-cyanophenyl)-2-[6-(trifluoromethyl)benzotriazol-1-yl]oxypropanamide (PubChem CID 9102658) has the molecular formula C17H12F3N5O2 and a molecular weight of 375.31 g/mol. Its IUPAC name is (2R)-N-(4-cyanophenyl)-2-[6-(trifluoromethyl)benzotriazol-1-yl]oxypropanamide.
| Compound Name | (2R)-N-(4-cyanophenyl)-2-[6-(trifluoromethyl)benzotriazol-1-yl]oxypropanamide |
|---|---|
| PubChem CID | 9102658 |
| Molecular Formula | C17H12F3N5O2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (2R)-N-(4-cyanophenyl)-2-[6-(trifluoromethyl)benzotriazol-1-yl]oxypropanamide |
| SMILES | C[C@@H](On1nnc2ccc(C(F)(F)F)cc21)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H12F3N5O2/c1-10(16(26)22-13-5-2-11(9-21)3-6-13)27-25-15-8-12(17(18,19)20)4-7-14(15)23-24-25/h2-8,10H,1H3,(H,22,26)/t10-/m1/s1 |
| InChIKey | QPHORCSYAFOAOU-SNVBAGLBSA-N |
| XLogP | 2.78 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |