C21H23F3N4O4S — CID 91026608
2-amino-N-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]acetamide (PubChem CID 91026608) has the molecular formula C21H23F3N4O4S and a molecular weight of 484.50 g/mol. Its IUPAC name is 2-amino-N-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]acetamide.
| Compound Name | 2-amino-N-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]acetamide |
|---|---|
| PubChem CID | 91026608 |
| Molecular Formula | C21H23F3N4O4S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 2-amino-N-[4-[[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]acetamide |
| SMILES | NCC(=O)Nc1ccc(S(=O)(=O)N2CC=C(NOCc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H23F3N4O4S/c22-21(23,24)16-3-1-2-15(12-16)14-32-27-18-8-10-28(11-9-18)33(30,31)19-6-4-17(5-7-19)26-20(29)13-25/h1-8,12,27H,9-11,13-14,25H2,(H,26,29) |
| InChIKey | RMLDCBQYNZYIBO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|