About 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol
1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol (PubChem CID 91032220) has the molecular formula C8H7N3OS
and a molecular weight of 193.23 g/mol. Its IUPAC name is 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol.
Analyze 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol?
The IUPAC name of 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol (CID 91032220) is 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol.
What is the SMILES notation for 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol?
The canonical SMILES for 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol is OC1(c2ncc3scnc3n2)CC1.
What is the InChIKey of 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol?
The InChIKey is LOPZVGPOXDHREM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3OS/c12-8(1-2-8)7-9-3-5-6(11-7)10-4-13-5/h3-4,12H,1-2H2.
What are the key properties of 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol?
1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol has a molecular weight of 193.23 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-([1,3]thiazolo[4,5-d]pyrimidin-5-yl)cyclopropan-1-ol is sourced from PubChem (CID 91032220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).