C7H3N3S — CID 91162638
5-ethynyl-[1,3]thiazolo[4,5-d]pyrimidine (PubChem CID 91162638) has the molecular formula C7H3N3S and a molecular weight of 161.19 g/mol. Its IUPAC name is 5-ethynyl-[1,3]thiazolo[4,5-d]pyrimidine.
| Compound Name | 5-ethynyl-[1,3]thiazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 91162638 |
| Molecular Formula | C7H3N3S |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.00 |
| IUPAC Name | 5-ethynyl-[1,3]thiazolo[4,5-d]pyrimidine |
| SMILES | C#Cc1ncc2scnc2n1 |
| InChI | InChI=1S/C7H3N3S/c1-2-6-8-3-5-7(10-6)9-4-11-5/h1,3-4H |
| InChIKey | RKLODDWANRECCG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|