C6H2N2S — CID 167729804
4-ethynyl-1,3-thiazole-5-carbonitrile (PubChem CID 167729804) has the molecular formula C6H2N2S and a molecular weight of 134.16 g/mol. Its IUPAC name is 4-ethynyl-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-ethynyl-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 167729804 |
| Molecular Formula | C6H2N2S |
| Molecular Weight | 134.16 g/mol |
| Exact Mass | 133.99 |
| IUPAC Name | 4-ethynyl-1,3-thiazole-5-carbonitrile |
| SMILES | C#Cc1ncsc1C#N |
| InChI | InChI=1S/C6H2N2S/c1-2-5-6(3-7)9-4-8-5/h1,4H |
| InChIKey | WYIOVLQNLRNTKD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.16 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|