C10H4BrFN2S — CID 116867007
4-(5-bromo-2-fluorophenyl)-1,3-thiazole-5-carbonitrile (PubChem CID 116867007) has the molecular formula C10H4BrFN2S and a molecular weight of 283.12 g/mol. Its IUPAC name is 4-(5-bromo-2-fluorophenyl)-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-(5-bromo-2-fluorophenyl)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 116867007 |
| Molecular Formula | C10H4BrFN2S |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | 4-(5-bromo-2-fluorophenyl)-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1scnc1-c1cc(Br)ccc1F |
| InChI | InChI=1S/C10H4BrFN2S/c11-6-1-2-8(12)7(3-6)10-9(4-13)15-5-14-10/h1-3,5H |
| InChIKey | NYHDYAOTZLBXOS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |