C8H4N2S — CID 88532618
2-ethynyl-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 88532618) has the molecular formula C8H4N2S and a molecular weight of 160.20 g/mol. Its IUPAC name is 2-ethynyl-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 2-ethynyl-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 88532618 |
| Molecular Formula | C8H4N2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 2-ethynyl-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | C#Cc1nc2ncccc2s1 |
| InChI | InChI=1S/C8H4N2S/c1-2-7-10-8-6(11-7)4-3-5-9-8/h1,3-5H |
| InChIKey | AOFUIMURAZBPJP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|