About thieno[2,3-d][1,3]thiazole;hydrobromide
thieno[2,3-d][1,3]thiazole;hydrobromide (PubChem CID 175569917) has the molecular formula C5H4BrNS2
and a molecular weight of 222.13 g/mol. Its IUPAC name is thieno[2,3-d][1,3]thiazole;hydrobromide.
Molecular Properties
| Compound Name | thieno[2,3-d][1,3]thiazole;hydrobromide |
| PubChem CID | 175569917 |
| Molecular Formula | C5H4BrNS2 |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 220.90 |
| IUPAC Name | thieno[2,3-d][1,3]thiazole;hydrobromide |
| SMILES | Br.c1nc2sccc2s1 |
| InChI | InChI=1S/C5H3NS2.BrH/c1-2-7-5-4(1)8-3-6-5;/h1-3H;1H |
| InChIKey | XPYNSGRTQGJGNQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[2,3-d][1,3]thiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[2,3-d][1,3]thiazole;hydrobromide?
The IUPAC name of thieno[2,3-d][1,3]thiazole;hydrobromide (CID 175569917) is thieno[2,3-d][1,3]thiazole;hydrobromide.
What is the SMILES notation for thieno[2,3-d][1,3]thiazole;hydrobromide?
The canonical SMILES for thieno[2,3-d][1,3]thiazole;hydrobromide is Br.c1nc2sccc2s1.
What is the InChIKey of thieno[2,3-d][1,3]thiazole;hydrobromide?
The InChIKey is XPYNSGRTQGJGNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3NS2.BrH/c1-2-7-5-4(1)8-3-6-5;/h1-3H;1H.
What are the key properties of thieno[2,3-d][1,3]thiazole;hydrobromide?
thieno[2,3-d][1,3]thiazole;hydrobromide has a molecular weight of 222.13 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[2,3-d][1,3]thiazole;hydrobromide is sourced from PubChem (CID 175569917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).