C19H18N2O10S2 — CID 91033121
1-methoxy-4-[2-[2-(4-methoxy-3-nitrophenyl)ethynylsulfonylmethylsulfonyl]ethyl]-2-nitrobenzene (PubChem CID 91033121) has the molecular formula C19H18N2O10S2 and a molecular weight of 498.49 g/mol. Its IUPAC name is 1-methoxy-4-[2-[2-(4-methoxy-3-nitrophenyl)ethynylsulfonylmethylsulfonyl]ethyl]-2-nitrobenzene.
| Compound Name | 1-methoxy-4-[2-[2-(4-methoxy-3-nitrophenyl)ethynylsulfonylmethylsulfonyl]ethyl]-2-nitrobenzene |
|---|---|
| PubChem CID | 91033121 |
| Molecular Formula | C19H18N2O10S2 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 1-methoxy-4-[2-[2-(4-methoxy-3-nitrophenyl)ethynylsulfonylmethylsulfonyl]ethyl]-2-nitrobenzene |
| SMILES | COc1ccc(C#CS(=O)(=O)CS(=O)(=O)CCc2ccc(OC)c([N+](=O)[O-])c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N2O10S2/c1-30-18-5-3-14(11-16(18)20(22)23)7-9-32(26,27)13-33(28,29)10-8-15-4-6-19(31-2)17(12-15)21(24)25/h3-6,11-12H,7,9,13H2,1-2H3 |
| InChIKey | HZDFTXMRRWRVBT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|