C19H20O8S2 — CID 91324180
4-[2-[2-(4-hydroxy-3-methoxyphenyl)ethynylsulfonylmethylsulfonyl]ethyl]-2-methoxyphenol (PubChem CID 91324180) has the molecular formula C19H20O8S2 and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-[2-[2-(4-hydroxy-3-methoxyphenyl)ethynylsulfonylmethylsulfonyl]ethyl]-2-methoxyphenol.
| Compound Name | 4-[2-[2-(4-hydroxy-3-methoxyphenyl)ethynylsulfonylmethylsulfonyl]ethyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 91324180 |
| Molecular Formula | C19H20O8S2 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 4-[2-[2-(4-hydroxy-3-methoxyphenyl)ethynylsulfonylmethylsulfonyl]ethyl]-2-methoxyphenol |
| SMILES | COc1cc(C#CS(=O)(=O)CS(=O)(=O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C19H20O8S2/c1-26-18-11-14(3-5-16(18)20)7-9-28(22,23)13-29(24,25)10-8-15-4-6-17(21)19(12-15)27-2/h3-6,11-12,20-21H,7,9,13H2,1-2H3 |
| InChIKey | KLVPYKNFBRHXEA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|