C14H20N2S — CID 91034064
1-(4-methylphenyl)-2-thia-1,3-diazaspiro[4.5]decane (PubChem CID 91034064) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-thia-1,3-diazaspiro[4.5]decane.
| Compound Name | 1-(4-methylphenyl)-2-thia-1,3-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 91034064 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(4-methylphenyl)-2-thia-1,3-diazaspiro[4.5]decane |
| SMILES | Cc1ccc(N2SNCC23CCCCC3)cc1 |
| InChI | InChI=1S/C14H20N2S/c1-12-5-7-13(8-6-12)16-14(11-15-17-16)9-3-2-4-10-14/h5-8,15H,2-4,9-11H2,1H3 |
| InChIKey | RSNVBJGGXMEILO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|