C24H19N3O5S3 — CID 91034236
2-[2-[5-(benzenesulfonyl)thiophen-2-yl]sulfonyl-5-pyridin-3-yl-1,3-dihydropyrazol-3-yl]phenol (PubChem CID 91034236) has the molecular formula C24H19N3O5S3 and a molecular weight of 525.63 g/mol. Its IUPAC name is 2-[2-[5-(benzenesulfonyl)thiophen-2-yl]sulfonyl-5-pyridin-3-yl-1,3-dihydropyrazol-3-yl]phenol.
| Compound Name | 2-[2-[5-(benzenesulfonyl)thiophen-2-yl]sulfonyl-5-pyridin-3-yl-1,3-dihydropyrazol-3-yl]phenol |
|---|---|
| PubChem CID | 91034236 |
| Molecular Formula | C24H19N3O5S3 |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | 2-[2-[5-(benzenesulfonyl)thiophen-2-yl]sulfonyl-5-pyridin-3-yl-1,3-dihydropyrazol-3-yl]phenol |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(S(=O)(=O)N2NC(c3cccnc3)=CC2c2ccccc2O)s1 |
| InChI | InChI=1S/C24H19N3O5S3/c28-22-11-5-4-10-19(22)21-15-20(17-7-6-14-25-16-17)26-27(21)35(31,32)24-13-12-23(33-24)34(29,30)18-8-2-1-3-9-18/h1-16,21,26,28H |
| InChIKey | OAINMPWFXIQHDY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|