C20H17N5O3S3 — CID 143708575
2-[2-[5-(2,3-dihydrothiadiazol-4-yl)thiophen-2-yl]sulfonyl-5-pyridin-3-yl-3,4-dihydropyrazol-3-yl]phenol (PubChem CID 143708575) has the molecular formula C20H17N5O3S3 and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-[2-[5-(2,3-dihydrothiadiazol-4-yl)thiophen-2-yl]sulfonyl-5-pyridin-3-yl-3,4-dihydropyrazol-3-yl]phenol.
| Compound Name | 2-[2-[5-(2,3-dihydrothiadiazol-4-yl)thiophen-2-yl]sulfonyl-5-pyridin-3-yl-3,4-dihydropyrazol-3-yl]phenol |
|---|---|
| PubChem CID | 143708575 |
| Molecular Formula | C20H17N5O3S3 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 2-[2-[5-(2,3-dihydrothiadiazol-4-yl)thiophen-2-yl]sulfonyl-5-pyridin-3-yl-3,4-dihydropyrazol-3-yl]phenol |
| SMILES | O=S(=O)(c1ccc(C2=CSNN2)s1)N1N=C(c2cccnc2)CC1c1ccccc1O |
| InChI | InChI=1S/C20H17N5O3S3/c26-18-6-2-1-5-14(18)17-10-15(13-4-3-9-21-11-13)23-25(17)31(27,28)20-8-7-19(30-20)16-12-29-24-22-16/h1-9,11-12,17,22,24,26H,10H2 |
| InChIKey | BPUVCDJHWJBIMJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|