C23H19Cl2F3N2O5S — CID 91034411
4-chloro-N-[[5-chloro-2-(2-ethoxybenzoyl)-3-pyridinyl]-methoxymethyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 91034411) has the molecular formula C23H19Cl2F3N2O5S and a molecular weight of 563.38 g/mol. Its IUPAC name is 4-chloro-N-[[5-chloro-2-(2-ethoxybenzoyl)-3-pyridinyl]-methoxymethyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[[5-chloro-2-(2-ethoxybenzoyl)-3-pyridinyl]-methoxymethyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91034411 |
| Molecular Formula | C23H19Cl2F3N2O5S |
| Molecular Weight | 563.38 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | 4-chloro-N-[[5-chloro-2-(2-ethoxybenzoyl)-3-pyridinyl]-methoxymethyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCOc1ccccc1C(=O)c1ncc(Cl)cc1C(NS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1)OC |
| InChI | InChI=1S/C23H19Cl2F3N2O5S/c1-3-35-19-7-5-4-6-15(19)21(31)20-16(10-13(24)12-29-20)22(34-2)30-36(32,33)14-8-9-18(25)17(11-14)23(26,27)28/h4-12,22,30H,3H2,1-2H3 |
| InChIKey | CCUMPOPXWAJLFL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.38 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|