C10H14N2 — CID 91034756
2,6-diazabicyclo[5.5.0]dodeca-1(7),8,10-triene (PubChem CID 91034756) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 2,6-diazabicyclo[5.5.0]dodeca-1(7),8,10-triene.
| Compound Name | 2,6-diazabicyclo[5.5.0]dodeca-1(7),8,10-triene |
|---|---|
| PubChem CID | 91034756 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2,6-diazabicyclo[5.5.0]dodeca-1(7),8,10-triene |
| SMILES | C1=CCC2=C(C=C1)NCCCN2 |
| InChI | InChI=1S/C10H14N2/c1-2-5-9-10(6-3-1)12-8-4-7-11-9/h1-3,5,11-12H,4,6-8H2 |
| InChIKey | KIEHOPVQIIWJJO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |