C9H15FN2 — CID 178128319
N'-(2-fluorocyclohexa-1,5-dien-1-yl)propane-1,3-diamine (PubChem CID 178128319) has the molecular formula C9H15FN2 and a molecular weight of 170.23 g/mol. Its IUPAC name is N'-(2-fluorocyclohexa-1,5-dien-1-yl)propane-1,3-diamine.
| Compound Name | N'-(2-fluorocyclohexa-1,5-dien-1-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 178128319 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | N'-(2-fluorocyclohexa-1,5-dien-1-yl)propane-1,3-diamine |
| SMILES | NCCCNC1=C(F)CCC=C1 |
| InChI | InChI=1S/C9H15FN2/c10-8-4-1-2-5-9(8)12-7-3-6-11/h2,5,12H,1,3-4,6-7,11H2 |
| InChIKey | XDIOVRRABVQDIU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|