C12H19NO3S — CID 91035286
1-(N-ethyl-3-methylanilino)propan-2-yl hydrogen sulfite (PubChem CID 91035286) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 1-(N-ethyl-3-methylanilino)propan-2-yl hydrogen sulfite.
| Compound Name | 1-(N-ethyl-3-methylanilino)propan-2-yl hydrogen sulfite |
|---|---|
| PubChem CID | 91035286 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-(N-ethyl-3-methylanilino)propan-2-yl hydrogen sulfite |
| SMILES | CCN(CC(C)OS(=O)O)c1cccc(C)c1 |
| InChI | InChI=1S/C12H19NO3S/c1-4-13(9-11(3)16-17(14)15)12-7-5-6-10(2)8-12/h5-8,11H,4,9H2,1-3H3,(H,14,15) |
| InChIKey | ZOFAIGUIZFOZQK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|